2-amino-4-(4-ethylphenyl)-1-(4-methoxyphenyl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carbonitrile
Chemical Structure Depiction of
2-amino-4-(4-ethylphenyl)-1-(4-methoxyphenyl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carbonitrile
2-amino-4-(4-ethylphenyl)-1-(4-methoxyphenyl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carbonitrile
Compound characteristics
| Compound ID: | 8007-1034 |
| Compound Name: | 2-amino-4-(4-ethylphenyl)-1-(4-methoxyphenyl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carbonitrile |
| Molecular Weight: | 399.49 |
| Molecular Formula: | C25 H25 N3 O2 |
| Smiles: | CCc1ccc(cc1)C1C(C#N)=C(N)N(C2CCCC(C1=2)=O)c1ccc(cc1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.98 |
| logD: | 3.98 |
| logSw: | -4.2957 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.921 |
| InChI Key: | WAYJTFBYEUVRNW-HSZRJFAPSA-N |