ethyl 3,3,3-trifluoro-N-(3-methylbutanoyl)-2-[(propan-2-yl)amino]alaninate
Chemical Structure Depiction of
ethyl 3,3,3-trifluoro-N-(3-methylbutanoyl)-2-[(propan-2-yl)amino]alaninate
ethyl 3,3,3-trifluoro-N-(3-methylbutanoyl)-2-[(propan-2-yl)amino]alaninate
Compound characteristics
| Compound ID: | 8007-1744 |
| Compound Name: | ethyl 3,3,3-trifluoro-N-(3-methylbutanoyl)-2-[(propan-2-yl)amino]alaninate |
| Molecular Weight: | 312.33 |
| Molecular Formula: | C13 H23 F3 N2 O3 |
| Smiles: | CCOC(C(C(F)(F)F)(NC(C)C)NC(CC(C)C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8353 |
| logD: | 2.5617 |
| logSw: | -3.0831 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.907 |
| InChI Key: | LVHYAIKTLQVAIW-GFCCVEGCSA-N |