3,4-dichloro-N'-[(4-methylphenyl)methylidene]benzohydrazide
Chemical Structure Depiction of
3,4-dichloro-N'-[(4-methylphenyl)methylidene]benzohydrazide
3,4-dichloro-N'-[(4-methylphenyl)methylidene]benzohydrazide
Compound characteristics
| Compound ID: | 8007-2191 |
| Compound Name: | 3,4-dichloro-N'-[(4-methylphenyl)methylidene]benzohydrazide |
| Molecular Weight: | 307.18 |
| Molecular Formula: | C15 H12 Cl2 N2 O |
| Smiles: | Cc1ccc(/C=N/NC(c2ccc(c(c2)[Cl])[Cl])=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.6717 |
| logD: | 4.3009 |
| logSw: | -5.0021 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.554 |
| InChI Key: | LPUKCFVBOOMEDD-UHFFFAOYSA-N |