4-(2-{[5-(4-chlorophenyl)furan-2-yl]methylidene}hydrazinyl)-N-phenyl-6-(piperidin-1-yl)-1,3,5-triazin-2-amine
Chemical Structure Depiction of
4-(2-{[5-(4-chlorophenyl)furan-2-yl]methylidene}hydrazinyl)-N-phenyl-6-(piperidin-1-yl)-1,3,5-triazin-2-amine
4-(2-{[5-(4-chlorophenyl)furan-2-yl]methylidene}hydrazinyl)-N-phenyl-6-(piperidin-1-yl)-1,3,5-triazin-2-amine
Compound characteristics
| Compound ID: | 8007-2341 |
| Compound Name: | 4-(2-{[5-(4-chlorophenyl)furan-2-yl]methylidene}hydrazinyl)-N-phenyl-6-(piperidin-1-yl)-1,3,5-triazin-2-amine |
| Molecular Weight: | 473.96 |
| Molecular Formula: | C25 H24 Cl N7 O |
| Smiles: | C1CCN(CC1)c1nc(Nc2ccccc2)nc(N/N=C/c2ccc(c3ccc(cc3)[Cl])o2)n1 |
| Stereo: | ACHIRAL |
| logP: | 7.9716 |
| logD: | 7.9713 |
| logSw: | -6.8071 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.372 |
| InChI Key: | WAKGUYGRUHVALM-UHFFFAOYSA-N |