1-({[3-nitro-4-(piperidin-1-yl)phenyl]methylidene}amino)-1H-tetrazol-5-amine
Chemical Structure Depiction of
1-({[3-nitro-4-(piperidin-1-yl)phenyl]methylidene}amino)-1H-tetrazol-5-amine
1-({[3-nitro-4-(piperidin-1-yl)phenyl]methylidene}amino)-1H-tetrazol-5-amine
Compound characteristics
| Compound ID: | 8007-2457 |
| Compound Name: | 1-({[3-nitro-4-(piperidin-1-yl)phenyl]methylidene}amino)-1H-tetrazol-5-amine |
| Molecular Weight: | 316.32 |
| Molecular Formula: | C13 H16 N8 O2 |
| Smiles: | C1CCN(CC1)c1ccc(/C=N/n2c(N)nnn2)cc1[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 1.1794 |
| logD: | 1.1794 |
| logSw: | -2.1937 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 106.031 |
| InChI Key: | MBMXWDHGHRXCPM-UHFFFAOYSA-N |