3-{2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione
Chemical Structure Depiction of
3-{2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione
3-{2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione
Compound characteristics
| Compound ID: | 8007-4848 |
| Compound Name: | 3-{2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione |
| Molecular Weight: | 380.22 |
| Molecular Formula: | C14 H10 Br N3 O3 S |
| Smiles: | C(\c1cc(ccc1O)[Br])=N/NC1c2ccccc2S(N=1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0007 |
| logD: | 1.808 |
| logSw: | -3.4107 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.617 |
| InChI Key: | SCCQLMZABUPXMZ-UHFFFAOYSA-N |