3,5-bis[(4-nitrophenyl)methylidene]-1-propylpiperidin-4-one
Chemical Structure Depiction of
3,5-bis[(4-nitrophenyl)methylidene]-1-propylpiperidin-4-one
3,5-bis[(4-nitrophenyl)methylidene]-1-propylpiperidin-4-one
Compound characteristics
| Compound ID: | 8007-6781 |
| Compound Name: | 3,5-bis[(4-nitrophenyl)methylidene]-1-propylpiperidin-4-one |
| Molecular Weight: | 407.42 |
| Molecular Formula: | C22 H21 N3 O5 |
| Smiles: | CCCN1C/C(=C\c2ccc(cc2)[N+]([O-])=O)C(C(\C1)=C\c1ccc(cc1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5108 |
| logD: | 4.5103 |
| logSw: | -4.1294 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 83.454 |
| InChI Key: | NOZCLEYRJPFYGD-UHFFFAOYSA-N |