N-(5-chloropyridin-2-yl)-1-(3-methylthiophen-2-yl)methanimine
Chemical Structure Depiction of
N-(5-chloropyridin-2-yl)-1-(3-methylthiophen-2-yl)methanimine
N-(5-chloropyridin-2-yl)-1-(3-methylthiophen-2-yl)methanimine
Compound characteristics
| Compound ID: | 8007-7115 |
| Compound Name: | N-(5-chloropyridin-2-yl)-1-(3-methylthiophen-2-yl)methanimine |
| Molecular Weight: | 236.72 |
| Molecular Formula: | C11 H9 Cl N2 S |
| Smiles: | Cc1ccsc1/C=N/c1ccc(cn1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.9798 |
| logD: | 3.9797 |
| logSw: | -4.1709 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 19.0888 |
| InChI Key: | SCZQIMGVVBLAKV-UHFFFAOYSA-N |