2-ethoxy-N'-[(3-phenoxyphenyl)methylidene]benzohydrazide
Chemical Structure Depiction of
2-ethoxy-N'-[(3-phenoxyphenyl)methylidene]benzohydrazide
2-ethoxy-N'-[(3-phenoxyphenyl)methylidene]benzohydrazide
Compound characteristics
| Compound ID: | 8007-7245 |
| Compound Name: | 2-ethoxy-N'-[(3-phenoxyphenyl)methylidene]benzohydrazide |
| Molecular Weight: | 360.41 |
| Molecular Formula: | C22 H20 N2 O3 |
| Smiles: | CCOc1ccccc1C(N/N=C/c1cccc(c1)Oc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8422 |
| logD: | 4.7679 |
| logSw: | -4.5306 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.512 |
| InChI Key: | QIYQJPBRZXQJNI-UHFFFAOYSA-N |