5-[(4-cyclohexylphenoxy)methyl]-4-phenyl-4H-1,2,4-triazole-3-thiol
Chemical Structure Depiction of
5-[(4-cyclohexylphenoxy)methyl]-4-phenyl-4H-1,2,4-triazole-3-thiol
5-[(4-cyclohexylphenoxy)methyl]-4-phenyl-4H-1,2,4-triazole-3-thiol
Compound characteristics
| Compound ID: | 8007-7519 |
| Compound Name: | 5-[(4-cyclohexylphenoxy)methyl]-4-phenyl-4H-1,2,4-triazole-3-thiol |
| Molecular Weight: | 365.5 |
| Molecular Formula: | C21 H23 N3 O S |
| Smiles: | C1CCC(CC1)c1ccc(cc1)OCc1nnc(n1c1ccccc1)S |
| Stereo: | ACHIRAL |
| logP: | 4.9566 |
| logD: | 3.6973 |
| logSw: | -4.7729 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.854 |
| InChI Key: | QRSCMYBTERWHIX-UHFFFAOYSA-N |