2-{[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene}hydrazine-1-carboxamide
Chemical Structure Depiction of
2-{[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene}hydrazine-1-carboxamide
2-{[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene}hydrazine-1-carboxamide
Compound characteristics
| Compound ID: | 8007-8009 |
| Compound Name: | 2-{[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene}hydrazine-1-carboxamide |
| Molecular Weight: | 304.26 |
| Molecular Formula: | C13 H12 N4 O5 |
| Smiles: | COc1cc(ccc1c1ccc(/C=N/NC(N)=O)o1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.8035 |
| logD: | 2.8035 |
| logSw: | -3.4289 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 105.105 |
| InChI Key: | UTTQLKOMYHTDIN-UHFFFAOYSA-N |