5-{2-[(4-methylphenyl)methylidene]hydrazinyl}-1-(naphthalen-1-yl)-1H-tetrazole
Chemical Structure Depiction of
5-{2-[(4-methylphenyl)methylidene]hydrazinyl}-1-(naphthalen-1-yl)-1H-tetrazole
5-{2-[(4-methylphenyl)methylidene]hydrazinyl}-1-(naphthalen-1-yl)-1H-tetrazole
Compound characteristics
| Compound ID: | 8007-8415 |
| Compound Name: | 5-{2-[(4-methylphenyl)methylidene]hydrazinyl}-1-(naphthalen-1-yl)-1H-tetrazole |
| Molecular Weight: | 328.37 |
| Molecular Formula: | C19 H16 N6 |
| Smiles: | Cc1ccc(/C=N/Nc2nnnn2c2cccc3ccccc23)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.6012 |
| logD: | 4.601 |
| logSw: | -4.8393 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.05 |
| InChI Key: | CLKGIIATOGFANC-UHFFFAOYSA-N |