5H-indeno[1,2-b]pyridin-5-one
Chemical Structure Depiction of
5H-indeno[1,2-b]pyridin-5-one
5H-indeno[1,2-b]pyridin-5-one
Compound characteristics
| Compound ID: | 8007-8535 |
| Compound Name: | 5H-indeno[1,2-b]pyridin-5-one |
| Molecular Weight: | 181.19 |
| Molecular Formula: | C12 H7 N O |
| Smiles: | c1ccc2c(c1)C(c1cccnc12)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9861 |
| logD: | 1.9861 |
| logSw: | -2.4009 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.3089 |
| InChI Key: | LAHFQGLEIGIEMT-UHFFFAOYSA-N |