4-({2-[(naphthalen-1-yl)acetyl]hydrazinylidene}methyl)phenyl 4-methylbenzene-1-sulfonate
Chemical Structure Depiction of
4-({2-[(naphthalen-1-yl)acetyl]hydrazinylidene}methyl)phenyl 4-methylbenzene-1-sulfonate
4-({2-[(naphthalen-1-yl)acetyl]hydrazinylidene}methyl)phenyl 4-methylbenzene-1-sulfonate
Compound characteristics
| Compound ID: | 8008-0498 |
| Compound Name: | 4-({2-[(naphthalen-1-yl)acetyl]hydrazinylidene}methyl)phenyl 4-methylbenzene-1-sulfonate |
| Molecular Weight: | 458.54 |
| Molecular Formula: | C26 H22 N2 O4 S |
| Smiles: | Cc1ccc(cc1)S(=O)(=O)Oc1ccc(/C=N/NC(Cc2cccc3ccccc23)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.4251 |
| logD: | 5.424 |
| logSw: | -6.4576 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.831 |
| InChI Key: | GPZMQXMTHOHYKN-UHFFFAOYSA-N |