N-(2,2-dinitropropyl)urea
Chemical Structure Depiction of
N-(2,2-dinitropropyl)urea
N-(2,2-dinitropropyl)urea
Compound characteristics
| Compound ID: | 8008-0850 |
| Compound Name: | N-(2,2-dinitropropyl)urea |
| Molecular Weight: | 192.13 |
| Molecular Formula: | C4 H8 N4 O5 |
| Smiles: | CC(CNC(N)=O)([N+]([O-])=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | -1.1742 |
| logD: | -1.1742 |
| logSw: | -0.6278 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 115.961 |
| InChI Key: | QEQDTVVNSGUGCW-UHFFFAOYSA-N |