N-(4-fluorophenyl)-3-[(3-fluorophenyl)sulfamoyl]benzamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-3-[(3-fluorophenyl)sulfamoyl]benzamide
N-(4-fluorophenyl)-3-[(3-fluorophenyl)sulfamoyl]benzamide
Compound characteristics
| Compound ID: | 8008-1140 |
| Compound Name: | N-(4-fluorophenyl)-3-[(3-fluorophenyl)sulfamoyl]benzamide |
| Molecular Weight: | 388.39 |
| Molecular Formula: | C19 H14 F2 N2 O3 S |
| Smiles: | c1cc(cc(c1)F)NS(c1cccc(c1)C(Nc1ccc(cc1)F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.931 |
| logD: | 3.2852 |
| logSw: | -4.1529 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.979 |
| InChI Key: | ZJUUCAMBEWUGHI-UHFFFAOYSA-N |