3-{[(furan-2-yl)methyl]sulfamoyl}-4-methoxy-N-phenylbenzamide
Chemical Structure Depiction of
3-{[(furan-2-yl)methyl]sulfamoyl}-4-methoxy-N-phenylbenzamide
3-{[(furan-2-yl)methyl]sulfamoyl}-4-methoxy-N-phenylbenzamide
Compound characteristics
| Compound ID: | 8008-1147 |
| Compound Name: | 3-{[(furan-2-yl)methyl]sulfamoyl}-4-methoxy-N-phenylbenzamide |
| Molecular Weight: | 386.42 |
| Molecular Formula: | C19 H18 N2 O5 S |
| Smiles: | COc1ccc(cc1S(NCc1ccco1)(=O)=O)C(Nc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0077 |
| logD: | 3.0073 |
| logSw: | -3.6746 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 80.467 |
| InChI Key: | IBHYHGZEAOIQGJ-UHFFFAOYSA-N |