methyl 2-amino-4-(4-bromophenyl)-1-(3-chloro-2-methylphenyl)-7,7-dimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Chemical Structure Depiction of
methyl 2-amino-4-(4-bromophenyl)-1-(3-chloro-2-methylphenyl)-7,7-dimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
methyl 2-amino-4-(4-bromophenyl)-1-(3-chloro-2-methylphenyl)-7,7-dimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 8008-1284 |
| Compound Name: | methyl 2-amino-4-(4-bromophenyl)-1-(3-chloro-2-methylphenyl)-7,7-dimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Molecular Weight: | 529.86 |
| Molecular Formula: | C26 H26 Br Cl N2 O3 |
| Smiles: | Cc1c(cccc1[Cl])N1C2CC(C)(C)CC(C=2C(C(=C1N)C(=O)OC)c1ccc(cc1)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.7238 |
| logD: | 5.7238 |
| logSw: | -6.1145 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.194 |
| InChI Key: | SULFWCIDGXYCCG-OAQYLSRUSA-N |