(2-bromophenyl){4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(2-bromophenyl){4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
(2-bromophenyl){4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | 8008-1429 |
| Compound Name: | (2-bromophenyl){4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl}methanone |
| Molecular Weight: | 458.23 |
| Molecular Formula: | C18 H15 Br F3 N3 O3 |
| Smiles: | C1CN(CCN1C(c1ccccc1[Br])=O)c1ccc(cc1[N+]([O-])=O)C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 3.9727 |
| logD: | 3.9727 |
| logSw: | -4.3659 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.927 |
| InChI Key: | SKUBCAXSSGGSCO-UHFFFAOYSA-N |