methyl 2-amino-5-oxo-4-phenyl-1-[3-(trifluoromethyl)phenyl]-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Chemical Structure Depiction of
methyl 2-amino-5-oxo-4-phenyl-1-[3-(trifluoromethyl)phenyl]-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
methyl 2-amino-5-oxo-4-phenyl-1-[3-(trifluoromethyl)phenyl]-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 8008-1542 |
| Compound Name: | methyl 2-amino-5-oxo-4-phenyl-1-[3-(trifluoromethyl)phenyl]-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Molecular Weight: | 442.44 |
| Molecular Formula: | C24 H21 F3 N2 O3 |
| Smiles: | COC(C1C(C2=C(CCCC2=O)N(C=1N)c1cccc(c1)C(F)(F)F)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0169 |
| logD: | 4.0169 |
| logSw: | -4.516 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.494 |
| InChI Key: | UFURXKHEKMHLRH-IBGZPJMESA-N |