N-(2-{[2-(butylamino)-2-oxoethyl]sulfanyl}-1,3-benzothiazol-6-yl)-4-methylbenzamide
					Chemical Structure Depiction of
N-(2-{[2-(butylamino)-2-oxoethyl]sulfanyl}-1,3-benzothiazol-6-yl)-4-methylbenzamide
			N-(2-{[2-(butylamino)-2-oxoethyl]sulfanyl}-1,3-benzothiazol-6-yl)-4-methylbenzamide
Compound characteristics
| Compound ID: | 8008-1807 | 
| Compound Name: | N-(2-{[2-(butylamino)-2-oxoethyl]sulfanyl}-1,3-benzothiazol-6-yl)-4-methylbenzamide | 
| Molecular Weight: | 413.56 | 
| Molecular Formula: | C21 H23 N3 O2 S2 | 
| Smiles: | CCCCNC(CSc1nc2ccc(cc2s1)NC(c1ccc(C)cc1)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.898 | 
| logD: | 4.8972 | 
| logSw: | -4.5855 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 56.724 | 
| InChI Key: | ZGVDAISAZIMUOY-UHFFFAOYSA-N | 
 
				 
				