5-{2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl}-3-(methylsulfanyl)-1,2-thiazole-4-carbonitrile
Chemical Structure Depiction of
5-{2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl}-3-(methylsulfanyl)-1,2-thiazole-4-carbonitrile
5-{2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl}-3-(methylsulfanyl)-1,2-thiazole-4-carbonitrile
Compound characteristics
| Compound ID: | 8008-3470 |
| Compound Name: | 5-{2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl}-3-(methylsulfanyl)-1,2-thiazole-4-carbonitrile |
| Molecular Weight: | 448.15 |
| Molecular Formula: | C12 H8 Br2 N4 O S2 |
| Smiles: | CSc1c(C#N)c(N/N=C/c2cc(cc(c2O)[Br])[Br])sn1 |
| Stereo: | ACHIRAL |
| logP: | 4.9579 |
| logD: | 4.8533 |
| logSw: | -4.5644 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.31 |
| InChI Key: | LJIAUAQUKINYIE-UHFFFAOYSA-N |