N-[2-(4-methylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-[2-(4-methylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide
N-[2-(4-methylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | 8008-3502 |
| Compound Name: | N-[2-(4-methylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide |
| Molecular Weight: | 329.42 |
| Molecular Formula: | C17 H19 N3 O2 S |
| Smiles: | CN1CCN(CC1)C(c1ccccc1NC(c1cccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9459 |
| logD: | 1.8084 |
| logSw: | -2.8051 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.775 |
| InChI Key: | RUPDRMZHKDHYIU-UHFFFAOYSA-N |