4-amino-5-bromo-1-pentofuranosylpyrimidin-2(1H)-one
Chemical Structure Depiction of
4-amino-5-bromo-1-pentofuranosylpyrimidin-2(1H)-one
4-amino-5-bromo-1-pentofuranosylpyrimidin-2(1H)-one
Compound characteristics
| Compound ID: | 8008-3571 |
| Compound Name: | 4-amino-5-bromo-1-pentofuranosylpyrimidin-2(1H)-one |
| Molecular Weight: | 322.11 |
| Molecular Formula: | C9 H12 Br N3 O5 |
| Smiles: | C(C1C(C(C(N2C=C(C(N)=NC2=O)[Br])O1)O)O)O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | -1.2882 |
| logD: | -1.2882 |
| logSw: | -0.2083 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 5 |
| Polar surface area: | 102.023 |
| InChI Key: | HRDXGYQCVPZEJE-UHFFFAOYSA-N |