2-{[2-(thiophen-2-yl)-1H-indol-3-yl]sulfanyl}acetohydrazide
Chemical Structure Depiction of
2-{[2-(thiophen-2-yl)-1H-indol-3-yl]sulfanyl}acetohydrazide
2-{[2-(thiophen-2-yl)-1H-indol-3-yl]sulfanyl}acetohydrazide
Compound characteristics
| Compound ID: | 8008-4227 |
| Compound Name: | 2-{[2-(thiophen-2-yl)-1H-indol-3-yl]sulfanyl}acetohydrazide |
| Molecular Weight: | 303.4 |
| Molecular Formula: | C14 H13 N3 O S2 |
| Smiles: | C(C(NN)=O)Sc1c2ccccc2[nH]c1c1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 1.8487 |
| logD: | 1.8487 |
| logSw: | -2.416 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 59.797 |
| InChI Key: | BLDVUMNFRYOLJA-UHFFFAOYSA-N |