3-{[5-(4-bromophenyl)furan-2-yl]methylidene}-1-(4-ethoxyphenyl)-5-phenyl-1,3-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
3-{[5-(4-bromophenyl)furan-2-yl]methylidene}-1-(4-ethoxyphenyl)-5-phenyl-1,3-dihydro-2H-pyrrol-2-one
3-{[5-(4-bromophenyl)furan-2-yl]methylidene}-1-(4-ethoxyphenyl)-5-phenyl-1,3-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | 8008-5064 |
| Compound Name: | 3-{[5-(4-bromophenyl)furan-2-yl]methylidene}-1-(4-ethoxyphenyl)-5-phenyl-1,3-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 512.4 |
| Molecular Formula: | C29 H22 Br N O3 |
| Smiles: | CCOc1ccc(cc1)N1C(=C/C(=C\c2ccc(c3ccc(cc3)[Br])o2)C1=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 7.6358 |
| logD: | 7.6358 |
| logSw: | -5.8892 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.7407 |
| InChI Key: | YOJPARMDBSAGTA-UHFFFAOYSA-N |