butyl 4-(4-ethoxy-3-methoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
butyl 4-(4-ethoxy-3-methoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
butyl 4-(4-ethoxy-3-methoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | 8008-5069 |
| Compound Name: | butyl 4-(4-ethoxy-3-methoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 362.42 |
| Molecular Formula: | C19 H26 N2 O5 |
| Smiles: | CCCCOC(C1C(c2ccc(c(c2)OC)OCC)NC(NC=1C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6368 |
| logD: | 2.4865 |
| logSw: | -3.0274 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.58 |
| InChI Key: | QEWHBDCWCOPWQQ-QGZVFWFLSA-N |