4-{[(3,4-dimethylphenyl)imino]methyl}-2-methoxyphenyl acetate
Chemical Structure Depiction of
4-{[(3,4-dimethylphenyl)imino]methyl}-2-methoxyphenyl acetate
4-{[(3,4-dimethylphenyl)imino]methyl}-2-methoxyphenyl acetate
Compound characteristics
| Compound ID: | 8008-5092 |
| Compound Name: | 4-{[(3,4-dimethylphenyl)imino]methyl}-2-methoxyphenyl acetate |
| Molecular Weight: | 297.35 |
| Molecular Formula: | C18 H19 N O3 |
| Smiles: | CC(=O)Oc1ccc(/C=N/c2ccc(C)c(C)c2)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 3.9968 |
| logD: | 3.9734 |
| logSw: | -4.2371 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.834 |
| InChI Key: | KKOBTWPRTYJYBI-UHFFFAOYSA-N |