2-[(2-fluorophenyl)carbamoyl]-6-nitrobenzoic acid
Chemical Structure Depiction of
2-[(2-fluorophenyl)carbamoyl]-6-nitrobenzoic acid
2-[(2-fluorophenyl)carbamoyl]-6-nitrobenzoic acid
Compound characteristics
| Compound ID: | 8008-5154 |
| Compound Name: | 2-[(2-fluorophenyl)carbamoyl]-6-nitrobenzoic acid |
| Molecular Weight: | 304.23 |
| Molecular Formula: | C14 H9 F N2 O5 |
| Smiles: | c1ccc(c(c1)NC(c1cccc(c1C(O)=O)[N+]([O-])=O)=O)F |
| Stereo: | ACHIRAL |
| logP: | 2.1378 |
| logD: | -4.0133 |
| logSw: | -2.9497 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 84.12 |
| InChI Key: | KSNCLEDXWGDCGX-UHFFFAOYSA-N |