1-[({3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl}methylidene)amino]-1H-tetrazol-5-amine
Chemical Structure Depiction of
1-[({3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl}methylidene)amino]-1H-tetrazol-5-amine
1-[({3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl}methylidene)amino]-1H-tetrazol-5-amine
Compound characteristics
| Compound ID: | 8008-5414 |
| Compound Name: | 1-[({3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl}methylidene)amino]-1H-tetrazol-5-amine |
| Molecular Weight: | 521 |
| Molecular Formula: | C15 H10 Br2 Cl2 N6 O |
| Smiles: | C(c1ccc(cc1[Cl])[Cl])Oc1c(/C=N/n2c(N)nnn2)cc(cc1[Br])[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.9515 |
| logD: | 4.9515 |
| logSw: | -5.0068 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.2 |
| InChI Key: | ISCLZETYOOCWGG-UHFFFAOYSA-N |