10a-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-3,10,10-trimethyl-3,4,10,10a-tetrahydropyrimido[1,2-a]indol-2(1H)-one
Chemical Structure Depiction of
10a-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-3,10,10-trimethyl-3,4,10,10a-tetrahydropyrimido[1,2-a]indol-2(1H)-one
10a-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-3,10,10-trimethyl-3,4,10,10a-tetrahydropyrimido[1,2-a]indol-2(1H)-one
Compound characteristics
| Compound ID: | 8008-5513 |
| Compound Name: | 10a-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-3,10,10-trimethyl-3,4,10,10a-tetrahydropyrimido[1,2-a]indol-2(1H)-one |
| Molecular Weight: | 375.51 |
| Molecular Formula: | C24 H29 N3 O |
| Smiles: | CC1CN2c3ccccc3C(C)(C)C2(/C=C/c2ccc(cc2)N(C)C)NC1=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.8132 |
| logD: | 4.813 |
| logSw: | -4.4278 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.1279 |
| InChI Key: | YXVYMGORJIFWRG-UHFFFAOYSA-N |