N-(2-chloro-4-nitrophenyl)-2-methylbenzamide
Chemical Structure Depiction of
N-(2-chloro-4-nitrophenyl)-2-methylbenzamide
N-(2-chloro-4-nitrophenyl)-2-methylbenzamide
Compound characteristics
| Compound ID: | 8008-6500 |
| Compound Name: | N-(2-chloro-4-nitrophenyl)-2-methylbenzamide |
| Molecular Weight: | 290.7 |
| Molecular Formula: | C14 H11 Cl N2 O3 |
| Smiles: | Cc1ccccc1C(Nc1ccc(cc1[Cl])[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6803 |
| logD: | 2.1232 |
| logSw: | -4.0291 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.013 |
| InChI Key: | SYKICVZDFRUTGU-UHFFFAOYSA-N |