N,N'-(1,4-phenylene)bis[2-(4-cyclohexylphenoxy)acetamide]
Chemical Structure Depiction of
N,N'-(1,4-phenylene)bis[2-(4-cyclohexylphenoxy)acetamide]
N,N'-(1,4-phenylene)bis[2-(4-cyclohexylphenoxy)acetamide]
Compound characteristics
| Compound ID: | 8008-7226 |
| Compound Name: | N,N'-(1,4-phenylene)bis[2-(4-cyclohexylphenoxy)acetamide] |
| Molecular Weight: | 540.7 |
| Molecular Formula: | C34 H40 N2 O4 |
| Smiles: | C1CCC(CC1)c1ccc(cc1)OCC(Nc1ccc(cc1)NC(COc1ccc(cc1)C1CCCCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 8.6077 |
| logD: | 8.6076 |
| logSw: | -6.1381 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 60.833 |
| InChI Key: | QPBKFUCTBIKCFK-UHFFFAOYSA-N |