3-[4-(diphenylmethyl)piperazin-1-yl]-1-(naphthalen-1-yl)pyrrolidine-2,5-dione
Chemical Structure Depiction of
3-[4-(diphenylmethyl)piperazin-1-yl]-1-(naphthalen-1-yl)pyrrolidine-2,5-dione
3-[4-(diphenylmethyl)piperazin-1-yl]-1-(naphthalen-1-yl)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 8008-7712 |
| Compound Name: | 3-[4-(diphenylmethyl)piperazin-1-yl]-1-(naphthalen-1-yl)pyrrolidine-2,5-dione |
| Molecular Weight: | 475.59 |
| Molecular Formula: | C31 H29 N3 O2 |
| Smiles: | C1C(C(N(C1=O)c1cccc2ccccc12)=O)N1CCN(CC1)C(c1ccccc1)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7305 |
| logD: | 4.7264 |
| logSw: | -5.5351 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 33.977 |
| InChI Key: | UVSZNZCOBJRENH-NDEPHWFRSA-N |