N-[2-(4-cyclohexylphenoxy)-4-(trifluoromethyl)phenyl]pyridine-3-carboxamide
Chemical Structure Depiction of
N-[2-(4-cyclohexylphenoxy)-4-(trifluoromethyl)phenyl]pyridine-3-carboxamide
N-[2-(4-cyclohexylphenoxy)-4-(trifluoromethyl)phenyl]pyridine-3-carboxamide
Compound characteristics
| Compound ID: | 8008-8058 |
| Compound Name: | N-[2-(4-cyclohexylphenoxy)-4-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| Molecular Weight: | 440.46 |
| Molecular Formula: | C25 H23 F3 N2 O2 |
| Smiles: | C1CCC(CC1)c1ccc(cc1)Oc1cc(ccc1NC(c1cccnc1)=O)C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 6.6494 |
| logD: | 6.6493 |
| logSw: | -6.0303 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.905 |
| InChI Key: | GULBSXOLOXALFB-UHFFFAOYSA-N |