4-nitro-N'-{[5-(2-nitrophenyl)furan-2-yl]methylidene}benzohydrazide
Chemical Structure Depiction of
4-nitro-N'-{[5-(2-nitrophenyl)furan-2-yl]methylidene}benzohydrazide
4-nitro-N'-{[5-(2-nitrophenyl)furan-2-yl]methylidene}benzohydrazide
Compound characteristics
| Compound ID: | 8008-9110 |
| Compound Name: | 4-nitro-N'-{[5-(2-nitrophenyl)furan-2-yl]methylidene}benzohydrazide |
| Molecular Weight: | 380.31 |
| Molecular Formula: | C18 H12 N4 O6 |
| Smiles: | C(\c1ccc(c2ccccc2[N+]([O-])=O)o1)=N/NC(c1ccc(cc1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9163 |
| logD: | 3.915 |
| logSw: | -4.3995 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 109.586 |
| InChI Key: | MVJMAKNMDAILLL-UHFFFAOYSA-N |