5,7a-dihydro-2H,4aH-cyclopenta[b][1,3]dithiolo[4,5-e][1,4]dithiine-2-thione
Chemical Structure Depiction of
5,7a-dihydro-2H,4aH-cyclopenta[b][1,3]dithiolo[4,5-e][1,4]dithiine-2-thione
5,7a-dihydro-2H,4aH-cyclopenta[b][1,3]dithiolo[4,5-e][1,4]dithiine-2-thione
Compound characteristics
| Compound ID: | 8008-9730 |
| Compound Name: | 5,7a-dihydro-2H,4aH-cyclopenta[b][1,3]dithiolo[4,5-e][1,4]dithiine-2-thione |
| Molecular Weight: | 262.45 |
| Molecular Formula: | C8 H6 S5 |
| Smiles: | C1C=CC2C1SC1=C(S2)SC(=S)S1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.6433 |
| logD: | 4.6433 |
| logSw: | -4.638 |
| Hydrogen bond acceptors count: | 6 |
| InChI Key: | NLJQLWTVZKGQKU-UHFFFAOYSA-N |