methyl 4-{3-methoxy-4-[(thiophene-2-carbonyl)oxy]phenyl}-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
methyl 4-{3-methoxy-4-[(thiophene-2-carbonyl)oxy]phenyl}-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
methyl 4-{3-methoxy-4-[(thiophene-2-carbonyl)oxy]phenyl}-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | 8008-9940 |
| Compound Name: | methyl 4-{3-methoxy-4-[(thiophene-2-carbonyl)oxy]phenyl}-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 402.42 |
| Molecular Formula: | C19 H18 N2 O6 S |
| Smiles: | CC1=C(C(c2ccc(c(c2)OC)OC(c2cccs2)=O)NC(N1)=O)C(=O)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.28 |
| logD: | 2.1298 |
| logSw: | -2.9485 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 85.979 |
| InChI Key: | SAEYZIWSKWETMU-INIZCTEOSA-N |