2-ethoxy-4-(2-oxo-1,2,3,4-tetrahydrobenzo[h]quinolin-4-yl)phenyl cyclopropanecarboxylate
Chemical Structure Depiction of
2-ethoxy-4-(2-oxo-1,2,3,4-tetrahydrobenzo[h]quinolin-4-yl)phenyl cyclopropanecarboxylate
2-ethoxy-4-(2-oxo-1,2,3,4-tetrahydrobenzo[h]quinolin-4-yl)phenyl cyclopropanecarboxylate
Compound characteristics
| Compound ID: | 8008-9942 |
| Compound Name: | 2-ethoxy-4-(2-oxo-1,2,3,4-tetrahydrobenzo[h]quinolin-4-yl)phenyl cyclopropanecarboxylate |
| Molecular Weight: | 401.46 |
| Molecular Formula: | C25 H23 N O4 |
| Smiles: | CCOc1cc(ccc1OC(C1CC1)=O)C1CC(Nc2c1ccc1ccccc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.248 |
| logD: | 4.248 |
| logSw: | -4.5957 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.462 |
| InChI Key: | XZDPDAYETUPZRM-HXUWFJFHSA-N |