4-chloro-2-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]phenol
Chemical Structure Depiction of
4-chloro-2-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]phenol
4-chloro-2-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]phenol
Compound characteristics
| Compound ID: | 8009-0743 |
| Compound Name: | 4-chloro-2-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]phenol |
| Molecular Weight: | 288.71 |
| Molecular Formula: | C15 H10 Cl F N2 O |
| Smiles: | c1cc(ccc1c1cc(c2cc(ccc2O)[Cl])n[nH]1)F |
| Stereo: | ACHIRAL |
| logP: | 5.1334 |
| logD: | 5.0136 |
| logSw: | -5.4166 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 39.005 |
| InChI Key: | SRMJCIBGUOPXNP-UHFFFAOYSA-N |