N~1~-[2-(4-chlorophenyl)ethyl]-N~2~-(propan-2-yl)ethanediamide
Chemical Structure Depiction of
N~1~-[2-(4-chlorophenyl)ethyl]-N~2~-(propan-2-yl)ethanediamide
N~1~-[2-(4-chlorophenyl)ethyl]-N~2~-(propan-2-yl)ethanediamide
Compound characteristics
| Compound ID: | 8009-1147 |
| Compound Name: | N~1~-[2-(4-chlorophenyl)ethyl]-N~2~-(propan-2-yl)ethanediamide |
| Molecular Weight: | 268.74 |
| Molecular Formula: | C13 H17 Cl N2 O2 |
| Smiles: | CC(C)NC(C(NCCc1ccc(cc1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6444 |
| logD: | 1.6419 |
| logSw: | -2.5385 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.424 |
| InChI Key: | DOCPFYZRWRPAFV-UHFFFAOYSA-N |