2-methoxy-4-(2-nitroprop-1-en-1-yl)-1-propoxybenzene
Chemical Structure Depiction of
2-methoxy-4-(2-nitroprop-1-en-1-yl)-1-propoxybenzene
2-methoxy-4-(2-nitroprop-1-en-1-yl)-1-propoxybenzene
Compound characteristics
| Compound ID: | 8009-1619 |
| Compound Name: | 2-methoxy-4-(2-nitroprop-1-en-1-yl)-1-propoxybenzene |
| Molecular Weight: | 251.28 |
| Molecular Formula: | C13 H17 N O4 |
| Smiles: | CCCOc1ccc(/C=C(/C)[N+]([O-])=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 3.0914 |
| logD: | 3.0914 |
| logSw: | -3.213 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.011 |
| InChI Key: | JJDJCBZOUZQCRG-UHFFFAOYSA-N |