5-({3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl}methylidene)-2-imino-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-({3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl}methylidene)-2-imino-1,3-thiazolidin-4-one
5-({3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl}methylidene)-2-imino-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 8009-1826 |
| Compound Name: | 5-({3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl}methylidene)-2-imino-1,3-thiazolidin-4-one |
| Molecular Weight: | 372.42 |
| Molecular Formula: | C19 H17 F N2 O3 S |
| Smiles: | CCOc1cc(\C=C2/C(NC(=N)S2)=O)ccc1OCc1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 2.7491 |
| logD: | 2.7476 |
| logSw: | -3.1886 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.038 |
| InChI Key: | ITGPTTGLVPSERW-UHFFFAOYSA-N |