(4-aminophenyl)[5-(4-fluorophenyl)-5-hydroxy-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-1-yl]methanone
Chemical Structure Depiction of
(4-aminophenyl)[5-(4-fluorophenyl)-5-hydroxy-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-1-yl]methanone
(4-aminophenyl)[5-(4-fluorophenyl)-5-hydroxy-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-1-yl]methanone
Compound characteristics
| Compound ID: | 8009-2232 |
| Compound Name: | (4-aminophenyl)[5-(4-fluorophenyl)-5-hydroxy-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-1-yl]methanone |
| Molecular Weight: | 367.3 |
| Molecular Formula: | C17 H13 F4 N3 O2 |
| Smiles: | C1C(C(F)(F)F)=NN(C(c2ccc(cc2)N)=O)C1(c1ccc(cc1)F)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3864 |
| logD: | 2.3864 |
| logSw: | -2.5019 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 64.324 |
| InChI Key: | DXPXUKHAAKAYIQ-INIZCTEOSA-N |