Nalpha-[(benzyloxy)carbonyl]-N-cycloheptyltryptophanamide
Chemical Structure Depiction of
Nalpha-[(benzyloxy)carbonyl]-N-cycloheptyltryptophanamide
Nalpha-[(benzyloxy)carbonyl]-N-cycloheptyltryptophanamide
Compound characteristics
| Compound ID: | 8009-2329 |
| Compound Name: | Nalpha-[(benzyloxy)carbonyl]-N-cycloheptyltryptophanamide |
| Molecular Weight: | 433.55 |
| Molecular Formula: | C26 H31 N3 O3 |
| Smiles: | C1CCCC(CC1)NC(C(Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.0079 |
| logD: | 6.0079 |
| logSw: | -6.1073 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 67.079 |
| InChI Key: | ZGXYTHWFZIANES-DEOSSOPVSA-N |