5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-cyclopentyl-2-(phenylimino)-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-cyclopentyl-2-(phenylimino)-1,3-thiazolidin-4-one
5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-cyclopentyl-2-(phenylimino)-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 8009-2365 |
| Compound Name: | 5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-cyclopentyl-2-(phenylimino)-1,3-thiazolidin-4-one |
| Molecular Weight: | 473.39 |
| Molecular Formula: | C22 H21 Br N2 O3 S |
| Smiles: | COc1cc(\C=C2/C(N(C3CCCC3)\C(=N/c3ccccc3)S2)=O)c(cc1O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.8664 |
| logD: | 4.8378 |
| logSw: | -4.3099 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.63 |
| InChI Key: | LPGDHWBNIJGIGM-UHFFFAOYSA-N |