2-{[1-([1,1'-biphenyl]-4-yl)ethylidene]hydrazinylidene}-3-ethyl-1,3-thiazolidin-4-one
Chemical Structure Depiction of
2-{[1-([1,1'-biphenyl]-4-yl)ethylidene]hydrazinylidene}-3-ethyl-1,3-thiazolidin-4-one
2-{[1-([1,1'-biphenyl]-4-yl)ethylidene]hydrazinylidene}-3-ethyl-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 8009-3041 |
| Compound Name: | 2-{[1-([1,1'-biphenyl]-4-yl)ethylidene]hydrazinylidene}-3-ethyl-1,3-thiazolidin-4-one |
| Molecular Weight: | 337.44 |
| Molecular Formula: | C19 H19 N3 O S |
| Smiles: | CCN1\C(=N/N=C(\C)c2ccc(cc2)c2ccccc2)SCC1=O |
| Stereo: | ACHIRAL |
| logP: | 4.5493 |
| logD: | 4.5493 |
| logSw: | -4.4424 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 35.692 |
| InChI Key: | SCLXNPBCMDHVQZ-UHFFFAOYSA-N |