1,3,3,6,7-pentamethyl-3,4-dihydroisoquinoline--hydrogen chloride (1/1)
Chemical Structure Depiction of
1,3,3,6,7-pentamethyl-3,4-dihydroisoquinoline--hydrogen chloride (1/1)
1,3,3,6,7-pentamethyl-3,4-dihydroisoquinoline--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 8009-3201 |
| Compound Name: | 1,3,3,6,7-pentamethyl-3,4-dihydroisoquinoline--hydrogen chloride (1/1) |
| Molecular Weight: | 237.77 |
| Molecular Formula: | C14 H19 N |
| Salt: | HCl |
| Smiles: | CC1c2cc(C)c(C)cc2CC(C)(C)N=1 |
| Stereo: | ACHIRAL |
| logP: | 3.9321 |
| logD: | 3.0366 |
| logSw: | -4.1134 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 7.2839 |
| InChI Key: | KVSKHGWQMZXGQL-UHFFFAOYSA-N |