1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione
Chemical Structure Depiction of
1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione
1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione
Compound characteristics
| Compound ID: | 8009-3775 |
| Compound Name: | 1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| Molecular Weight: | 296.35 |
| Molecular Formula: | C16 H12 N2 O2 S |
| Smiles: | C1C(N(C(N(C1=O)c1ccccc1)=S)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.3997 |
| logD: | -5.6129 |
| logSw: | -1.9726 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 31.3476 |
| InChI Key: | ZFIMUSUHAOSEIE-UHFFFAOYSA-N |