N~1~-(4-methylphenyl)-N~2~-{4-[1-(naphthalene-2-sulfonyl)piperidin-3-yl]butyl}ethanediamide
Chemical Structure Depiction of
N~1~-(4-methylphenyl)-N~2~-{4-[1-(naphthalene-2-sulfonyl)piperidin-3-yl]butyl}ethanediamide
N~1~-(4-methylphenyl)-N~2~-{4-[1-(naphthalene-2-sulfonyl)piperidin-3-yl]butyl}ethanediamide
Compound characteristics
| Compound ID: | 8009-3877 |
| Compound Name: | N~1~-(4-methylphenyl)-N~2~-{4-[1-(naphthalene-2-sulfonyl)piperidin-3-yl]butyl}ethanediamide |
| Molecular Weight: | 507.65 |
| Molecular Formula: | C28 H33 N3 O4 S |
| Smiles: | Cc1ccc(cc1)NC(C(NCCCCC1CCCN(C1)S(c1ccc2ccccc2c1)(=O)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8214 |
| logD: | 4.7 |
| logSw: | -5.3379 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.229 |
| InChI Key: | CBICPLYVLNSDTG-QFIPXVFZSA-N |